C16H13FNOP — CID 71175511
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-phenylphosphane (PubChem CID 71175511) has the molecular formula C16H13FNOP and a molecular weight of 285.26 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-phenylphosphane.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-phenylphosphane |
|---|---|
| PubChem CID | 71175511 |
| Molecular Formula | C16H13FNOP |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-phenylphosphane |
| SMILES | Fc1ccc(-c2cnc(CPc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C16H13FNOP/c17-13-8-6-12(7-9-13)15-10-18-16(19-15)11-20-14-4-2-1-3-5-14/h1-10,20H,11H2 |
| InChIKey | CAZMQLSWNMFGMS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|