C16H12FNO2S — CID 62001067
2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]phenol (PubChem CID 62001067) has the molecular formula C16H12FNO2S and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]phenol.
| Compound Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 62001067 |
| Molecular Formula | C16H12FNO2S |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methylsulfanyl]phenol |
| SMILES | Oc1ccccc1SCc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H12FNO2S/c17-12-7-5-11(6-8-12)14-9-18-16(20-14)10-21-15-4-2-1-3-13(15)19/h1-9,19H,10H2 |
| InChIKey | IZEXNQKQTDWEHI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |