C16H10F3NO — CID 102005963
5-phenyl-2-[(3,4,5-trifluorophenyl)methyl]-1,3-oxazole (PubChem CID 102005963) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is 5-phenyl-2-[(3,4,5-trifluorophenyl)methyl]-1,3-oxazole.
| Compound Name | 5-phenyl-2-[(3,4,5-trifluorophenyl)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 102005963 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-phenyl-2-[(3,4,5-trifluorophenyl)methyl]-1,3-oxazole |
| SMILES | Fc1cc(Cc2ncc(-c3ccccc3)o2)cc(F)c1F |
| InChI | InChI=1S/C16H10F3NO/c17-12-6-10(7-13(18)16(12)19)8-15-20-9-14(21-15)11-4-2-1-3-5-11/h1-7,9H,8H2 |
| InChIKey | MENOHASNYZFILT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|