C25H18ClN3O3 — CID 4786114
1-benzyl-6-chloro-4-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinoxaline-2,3-dione (PubChem CID 4786114) has the molecular formula C25H18ClN3O3 and a molecular weight of 443.89 g/mol. Its IUPAC name is 1-benzyl-6-chloro-4-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinoxaline-2,3-dione.
| Compound Name | 1-benzyl-6-chloro-4-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 4786114 |
| Molecular Formula | C25H18ClN3O3 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 1-benzyl-6-chloro-4-[(5-phenyl-1,3-oxazol-2-yl)methyl]quinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(Cc2ncc(-c3ccccc3)o2)c2cc(Cl)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C25H18ClN3O3/c26-19-11-12-20-21(13-19)29(16-23-27-14-22(32-23)18-9-5-2-6-10-18)25(31)24(30)28(20)15-17-7-3-1-4-8-17/h1-14H,15-16H2 |
| InChIKey | BLWVCWOYGFVBLM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 70.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|