C20H18FNO4 — CID 60541333
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 3-phenylmethoxypropanoate (PubChem CID 60541333) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 3-phenylmethoxypropanoate.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 3-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 60541333 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 3-phenylmethoxypropanoate |
| SMILES | O=C(CCOCc1ccccc1)OCc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C20H18FNO4/c21-17-8-6-16(7-9-17)18-12-22-19(26-18)14-25-20(23)10-11-24-13-15-4-2-1-3-5-15/h1-9,12H,10-11,13-14H2 |
| InChIKey | YJIWOKVHBQKARO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|