C19H18N2O3 — CID 72648141
benzyl 2-amino-3-(5-phenyl-1,3-oxazol-2-yl)propanoate (PubChem CID 72648141) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl 2-amino-3-(5-phenyl-1,3-oxazol-2-yl)propanoate.
| Compound Name | benzyl 2-amino-3-(5-phenyl-1,3-oxazol-2-yl)propanoate |
|---|---|
| PubChem CID | 72648141 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | benzyl 2-amino-3-(5-phenyl-1,3-oxazol-2-yl)propanoate |
| SMILES | NC(Cc1ncc(-c2ccccc2)o1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H18N2O3/c20-16(19(22)23-13-14-7-3-1-4-8-14)11-18-21-12-17(24-18)15-9-5-2-6-10-15/h1-10,12,16H,11,13,20H2 |
| InChIKey | OVCWCBOXAYASLJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |