C22H25N3O3 — CID 174391409
azane;benzyl 2-amino-3-(5-phenylmethoxy-2-pyridinyl)propanoate (PubChem CID 174391409) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is azane;benzyl 2-amino-3-(5-phenylmethoxy-2-pyridinyl)propanoate.
| Compound Name | azane;benzyl 2-amino-3-(5-phenylmethoxy-2-pyridinyl)propanoate |
|---|---|
| PubChem CID | 174391409 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | azane;benzyl 2-amino-3-(5-phenylmethoxy-2-pyridinyl)propanoate |
| SMILES | N.NC(Cc1ccc(OCc2ccccc2)cn1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O3.H3N/c23-21(22(25)27-16-18-9-5-2-6-10-18)13-19-11-12-20(14-24-19)26-15-17-7-3-1-4-8-17;/h1-12,14,21H,13,15-16,23H2;1H3 |
| InChIKey | ZQVBNYNJOITITB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |