C20H24N2O6 — CID 141065131
2-[carboxy-[(2-methylpropan-2-yl)oxy]amino]-3-(5-phenylmethoxy-2-pyridinyl)propanoic acid (PubChem CID 141065131) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2-[carboxy-[(2-methylpropan-2-yl)oxy]amino]-3-(5-phenylmethoxy-2-pyridinyl)propanoic acid.
| Compound Name | 2-[carboxy-[(2-methylpropan-2-yl)oxy]amino]-3-(5-phenylmethoxy-2-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 141065131 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[carboxy-[(2-methylpropan-2-yl)oxy]amino]-3-(5-phenylmethoxy-2-pyridinyl)propanoic acid |
| SMILES | CC(C)(C)ON(C(=O)O)C(Cc1ccc(OCc2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C20H24N2O6/c1-20(2,3)28-22(19(25)26)17(18(23)24)11-15-9-10-16(12-21-15)27-13-14-7-5-4-6-8-14/h4-10,12,17H,11,13H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | RSMVFJMANGTZIH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|