C19H21LiN2O5 — CID 153367842
lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-phenylmethoxy-2-pyridinyl)acetate (PubChem CID 153367842) has the molecular formula C19H21LiN2O5 and a molecular weight of 364.33 g/mol. Its IUPAC name is lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-phenylmethoxy-2-pyridinyl)acetate.
| Compound Name | lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-phenylmethoxy-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 153367842 |
| Molecular Formula | C19H21LiN2O5 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-phenylmethoxy-2-pyridinyl)acetate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)[O-])c1ccc(OCc2ccccc2)cn1.[Li+] |
| InChI | InChI=1S/C19H22N2O5.Li/c1-19(2,3)26-18(24)21-16(17(22)23)15-10-9-14(11-20-15)25-12-13-7-5-4-6-8-13;/h4-11,16H,12H2,1-3H3,(H,21,24)(H,22,23);/q;+1/p-1 |
| InChIKey | ZQGNJRZHPNXQOQ-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |