C13H17LiN2O4 — CID 153368014
lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-methyl-2-pyridinyl)acetate (PubChem CID 153368014) has the molecular formula C13H17LiN2O4 and a molecular weight of 272.23 g/mol. Its IUPAC name is lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-methyl-2-pyridinyl)acetate.
| Compound Name | lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-methyl-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 153368014 |
| Molecular Formula | C13H17LiN2O4 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | lithium 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(5-methyl-2-pyridinyl)acetate |
| SMILES | Cc1ccc(C(NC(=O)OC(C)(C)C)C(=O)[O-])nc1.[Li+] |
| InChI | InChI=1S/C13H18N2O4.Li/c1-8-5-6-9(14-7-8)10(11(16)17)15-12(18)19-13(2,3)4;/h5-7,10H,1-4H3,(H,15,18)(H,16,17);/q;+1/p-1 |
| InChIKey | HIRBRLCEMPYKIF-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |