C23H17FN2O5S — CID 16595735
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 4-(phenylsulfamoyl)benzoate (PubChem CID 16595735) has the molecular formula C23H17FN2O5S and a molecular weight of 452.46 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 4-(phenylsulfamoyl)benzoate.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 4-(phenylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 16595735 |
| Molecular Formula | C23H17FN2O5S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 4-(phenylsulfamoyl)benzoate |
| SMILES | O=C(OCc1ncc(-c2ccc(F)cc2)o1)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H17FN2O5S/c24-18-10-6-16(7-11-18)21-14-25-22(31-21)15-30-23(27)17-8-12-20(13-9-17)32(28,29)26-19-4-2-1-3-5-19/h1-14,26H,15H2 |
| InChIKey | TUJNVTBNDHINPQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |