C22H17N3O4S — CID 19258755
4-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]sulfonylamino]benzamide (PubChem CID 19258755) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is 4-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]sulfonylamino]benzamide.
| Compound Name | 4-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]sulfonylamino]benzamide |
|---|---|
| PubChem CID | 19258755 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 4-[[4-(5-phenyl-1,3-oxazol-2-yl)phenyl]sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(NS(=O)(=O)c2ccc(-c3ncc(-c4ccccc4)o3)cc2)cc1 |
| InChI | InChI=1S/C22H17N3O4S/c23-21(26)16-6-10-18(11-7-16)25-30(27,28)19-12-8-17(9-13-19)22-24-14-20(29-22)15-4-2-1-3-5-15/h1-14,25H,(H2,23,26) |
| InChIKey | DNJZGVRTISETBC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |