C17H12BrFN2O3 — CID 16592037
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-amino-5-bromobenzoate (PubChem CID 16592037) has the molecular formula C17H12BrFN2O3 and a molecular weight of 391.20 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-amino-5-bromobenzoate.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-amino-5-bromobenzoate |
|---|---|
| PubChem CID | 16592037 |
| Molecular Formula | C17H12BrFN2O3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-amino-5-bromobenzoate |
| SMILES | Nc1ccc(Br)cc1C(=O)OCc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H12BrFN2O3/c18-11-3-6-14(20)13(7-11)17(22)23-9-16-21-8-15(24-16)10-1-4-12(19)5-2-10/h1-8H,9,20H2 |
| InChIKey | QYPGHMABBDEVSP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|