C19H13ClN2O3 — CID 8607373
[5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl 1H-indole-3-carboxylate (PubChem CID 8607373) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl 1H-indole-3-carboxylate.
| Compound Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8607373 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3-oxazol-2-yl]methyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCc1ncc(-c2ccc(Cl)cc2)o1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H13ClN2O3/c20-13-7-5-12(6-8-13)17-10-22-18(25-17)11-24-19(23)15-9-21-16-4-2-1-3-14(15)16/h1-10,21H,11H2 |
| InChIKey | NBSCBTOLHZNAPF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |