C18H13FN2O6 — CID 35199686
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-methoxy-5-nitrobenzoate (PubChem CID 35199686) has the molecular formula C18H13FN2O6 and a molecular weight of 372.31 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-methoxy-5-nitrobenzoate.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-methoxy-5-nitrobenzoate |
|---|---|
| PubChem CID | 35199686 |
| Molecular Formula | C18H13FN2O6 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl 2-methoxy-5-nitrobenzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(=O)OCc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H13FN2O6/c1-25-15-7-6-13(21(23)24)8-14(15)18(22)26-10-17-20-9-16(27-17)11-2-4-12(19)5-3-11/h2-9H,10H2,1H3 |
| InChIKey | GSIUFLZLVIHEOQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|