C18H12BrClFNO3 — CID 16591932
(4-bromo-2-chlorophenyl) 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 16591932) has the molecular formula C18H12BrClFNO3 and a molecular weight of 424.65 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | (4-bromo-2-chlorophenyl) 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 16591932 |
| Molecular Formula | C18H12BrClFNO3 |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2)o1)Oc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H12BrClFNO3/c19-12-3-6-15(14(20)9-12)25-18(23)8-7-17-22-10-16(24-17)11-1-4-13(21)5-2-11/h1-6,9-10H,7-8H2 |
| InChIKey | ZSYCIJOAQRGPKA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|