C18H13BrClNO3 — CID 16591931
(4-bromo-2-chlorophenyl) 3-(5-phenyl-1,3-oxazol-2-yl)propanoate (PubChem CID 16591931) has the molecular formula C18H13BrClNO3 and a molecular weight of 406.66 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 3-(5-phenyl-1,3-oxazol-2-yl)propanoate.
| Compound Name | (4-bromo-2-chlorophenyl) 3-(5-phenyl-1,3-oxazol-2-yl)propanoate |
|---|---|
| PubChem CID | 16591931 |
| Molecular Formula | C18H13BrClNO3 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 3-(5-phenyl-1,3-oxazol-2-yl)propanoate |
| SMILES | O=C(CCc1ncc(-c2ccccc2)o1)Oc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H13BrClNO3/c19-13-6-7-15(14(20)10-13)24-18(22)9-8-17-21-11-16(23-17)12-4-2-1-3-5-12/h1-7,10-11H,8-9H2 |
| InChIKey | CWPZHCXNLSSJGH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|