C23H20ClNO6 — CID 36835094
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 36835094) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 36835094 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | COC(=O)/C=C/c1ccc(OC(=O)CCc2ncc(-c3ccc(Cl)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C23H20ClNO6/c1-28-19-13-15(4-11-22(26)29-2)3-9-18(19)31-23(27)12-10-21-25-14-20(30-21)16-5-7-17(24)8-6-16/h3-9,11,13-14H,10,12H2,1-2H3/b11-4+ |
| InChIKey | APQKQFUQHSNEOB-NYYWCZLTSA-N |
| XLogP | 4.73 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|