C12H9BrFNO2 — CID 162401622
3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoyl fluoride (PubChem CID 162401622) has the molecular formula C12H9BrFNO2 and a molecular weight of 298.11 g/mol. Its IUPAC name is 3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoyl fluoride.
| Compound Name | 3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoyl fluoride |
|---|---|
| PubChem CID | 162401622 |
| Molecular Formula | C12H9BrFNO2 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 3-[5-(4-bromophenyl)-1,3-oxazol-2-yl]propanoyl fluoride |
| SMILES | O=C(F)CCc1ncc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C12H9BrFNO2/c13-9-3-1-8(2-4-9)10-7-15-12(17-10)6-5-11(14)16/h1-4,7H,5-6H2 |
| InChIKey | GQNYNDYYDZRVLH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|