C20H16FNO4 — CID 42490600
phenacyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate (PubChem CID 42490600) has the molecular formula C20H16FNO4 and a molecular weight of 353.35 g/mol. Its IUPAC name is phenacyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate.
| Compound Name | phenacyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
|---|---|
| PubChem CID | 42490600 |
| Molecular Formula | C20H16FNO4 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | phenacyl 3-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]propanoate |
| SMILES | O=C(CCc1ncc(-c2ccc(F)cc2)o1)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16FNO4/c21-16-8-6-15(7-9-16)18-12-22-19(26-18)10-11-20(24)25-13-17(23)14-4-2-1-3-5-14/h1-9,12H,10-11,13H2 |
| InChIKey | NHPOODCFSJIQFK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |