C21H25IN4O — CID 111799457
2-methyl-1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111799457) has the molecular formula C21H25IN4O and a molecular weight of 476.36 g/mol. Its IUPAC name is 2-methyl-1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111799457 |
| Molecular Formula | C21H25IN4O |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-methyl-1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1)NCc1ncc(-c2ccc(C)cc2)o1.I |
| InChI | InChI=1S/C21H24N4O.HI/c1-16-8-10-18(11-9-16)19-14-24-20(26-19)15-25-21(22-2)23-13-12-17-6-4-3-5-7-17;/h3-11,14H,12-13,15H2,1-2H3,(H2,22,23,25);1H |
| InChIKey | WKDZQXXLWPXYPG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|