C15H23IN6 — CID 111135550
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111135550) has the molecular formula C15H23IN6 and a molecular weight of 414.30 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111135550 |
| Molecular Formula | C15H23IN6 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccccc1)NCc1nnc(C)n1C.I |
| InChI | InChI=1S/C15H22N6.HI/c1-12-19-20-14(21(12)3)11-18-15(16-2)17-10-9-13-7-5-4-6-8-13;/h4-8H,9-11H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | GGHNYCBMPGDNMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|