C13H20N6S — CID 111350194
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111350194) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111350194 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NCc1nnc(C)n1C |
| InChI | InChI=1S/C13H20N6S/c1-10-17-18-12(19(10)3)9-16-13(14-2)15-7-6-11-5-4-8-20-11/h4-5,8H,6-7,9H2,1-3H3,(H2,14,15,16) |
| InChIKey | LLUGEEVUFWNQJR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|