C20H22N4O — CID 111822676
2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1-(2-phenylethyl)guanidine (PubChem CID 111822676) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1-(2-phenylethyl)guanidine.
| Compound Name | 2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111822676 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1-(2-phenylethyl)guanidine |
| SMILES | Cc1ccc(-c2cnc(C/N=C(\N)NCCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C20H22N4O/c1-15-7-9-17(10-8-15)18-13-23-19(25-18)14-24-20(21)22-12-11-16-5-3-2-4-6-16/h2-10,13H,11-12,14H2,1H3,(H3,21,22,24) |
| InChIKey | OWYMXJAZIPZRBV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|