C20H20F3IN4O2 — CID 111822653
1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111822653) has the molecular formula C20H20F3IN4O2 and a molecular weight of 532.30 g/mol. Its IUPAC name is 1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111822653 |
| Molecular Formula | C20H20F3IN4O2 |
| Molecular Weight | 532.30 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 1-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(-c2cnc(CN/C(N)=N/Cc3ccc(OC(F)(F)F)cc3)o2)cc1.I |
| InChI | InChI=1S/C20H19F3N4O2.HI/c1-13-2-6-15(7-3-13)17-11-25-18(28-17)12-27-19(24)26-10-14-4-8-16(9-5-14)29-20(21,22)23;/h2-9,11H,10,12H2,1H3,(H3,24,26,27);1H |
| InChIKey | AIDMNHXDFRODDV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|