C19H18F3IN4O2 — CID 111599149
1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111599149) has the molecular formula C19H18F3IN4O2 and a molecular weight of 518.28 g/mol. Its IUPAC name is 1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111599149 |
| Molecular Formula | C19H18F3IN4O2 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 1-[(5-phenyl-1,3-oxazol-2-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H17F3N4O2.HI/c20-19(21,22)28-15-8-6-13(7-9-15)10-25-18(23)26-12-17-24-11-16(27-17)14-4-2-1-3-5-14;/h1-9,11H,10,12H2,(H3,23,25,26);1H |
| InChIKey | QEKUPGLAHHTUOJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|