C21H22F3N5O — CID 111597794
1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111597794) has the molecular formula C21H22F3N5O and a molecular weight of 417.44 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111597794 |
| Molecular Formula | C21H22F3N5O |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 1-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N5O/c1-14-19(15(2)29(28-14)17-6-4-3-5-7-17)13-27-20(25)26-12-16-8-10-18(11-9-16)30-21(22,23)24/h3-11H,12-13H2,1-2H3,(H3,25,26,27) |
| InChIKey | XPZSWUNFSGEPQO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|