C11H13ClN2O — CID 138039801
(1R)-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine;hydrochloride (PubChem CID 138039801) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (1R)-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine;hydrochloride.
| Compound Name | (1R)-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 138039801 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (1R)-1-(5-phenyl-1,3-oxazol-2-yl)ethanamine;hydrochloride |
| SMILES | C[C@@H](N)c1ncc(-c2ccccc2)o1.Cl |
| InChI | InChI=1S/C11H12N2O.ClH/c1-8(12)11-13-7-10(14-11)9-5-3-2-4-6-9;/h2-8H,12H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | RTZFFHFGTIDJNQ-DDWIOCJRSA-N |
| XLogP | 2.78 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |