About 5-phenyl-1,3-oxazole-2-carbaldehyde
5-phenyl-1,3-oxazole-2-carbaldehyde (PubChem CID 13352176) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 5-phenyl-1,3-oxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-phenyl-1,3-oxazole-2-carbaldehyde |
| PubChem CID | 13352176 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 5-phenyl-1,3-oxazole-2-carbaldehyde |
| SMILES | O=Cc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C10H7NO2/c12-7-10-11-6-9(13-10)8-4-2-1-3-5-8/h1-7H |
| InChIKey | GJRAYWVAZQGENN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-1,3-oxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,3-oxazole-2-carbaldehyde?
The IUPAC name of 5-phenyl-1,3-oxazole-2-carbaldehyde (CID 13352176) is 5-phenyl-1,3-oxazole-2-carbaldehyde.
What is the SMILES notation for 5-phenyl-1,3-oxazole-2-carbaldehyde?
The canonical SMILES for 5-phenyl-1,3-oxazole-2-carbaldehyde is O=Cc1ncc(-c2ccccc2)o1.
What is the InChIKey of 5-phenyl-1,3-oxazole-2-carbaldehyde?
The InChIKey is GJRAYWVAZQGENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-7-10-11-6-9(13-10)8-4-2-1-3-5-8/h1-7H.
What are the key properties of 5-phenyl-1,3-oxazole-2-carbaldehyde?
5-phenyl-1,3-oxazole-2-carbaldehyde has a molecular weight of 173.17 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3-oxazole-2-carbaldehyde is sourced from PubChem (CID 13352176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).