C18H15NO2 — CID 12639615
5-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]-1,3-oxazole (PubChem CID 12639615) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]-1,3-oxazole.
| Compound Name | 5-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 12639615 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-[(E)-2-phenylethenyl]-1,3-oxazole |
| SMILES | COc1ccc(-c2cnc(/C=C/c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C18H15NO2/c1-20-16-10-8-15(9-11-16)17-13-19-18(21-17)12-7-14-5-3-2-4-6-14/h2-13H,1H3/b12-7+ |
| InChIKey | PEAJQPSRMOFMSM-KPKJPENVSA-N |
| XLogP | 4.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |