C13H11NO2 — CID 11790547
5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-6-one (PubChem CID 11790547) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-6-one.
| Compound Name | 5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 11790547 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 5-methyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-6-one |
| SMILES | Cc1cnc(/C=C/c2ccccc2)oc1=O |
| InChI | InChI=1S/C13H11NO2/c1-10-9-14-12(16-13(10)15)8-7-11-5-3-2-4-6-11/h2-9H,1H3/b8-7+ |
| InChIKey | AUVZRPDPOLGYNC-BQYQJAHWSA-N |
| XLogP | 2.51 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |