C16H9Cl2NO2 — CID 134096982
5,8-dichloro-2-[(E)-2-phenylethenyl]-3,1-benzoxazin-4-one (PubChem CID 134096982) has the molecular formula C16H9Cl2NO2 and a molecular weight of 318.16 g/mol. Its IUPAC name is 5,8-dichloro-2-[(E)-2-phenylethenyl]-3,1-benzoxazin-4-one.
| Compound Name | 5,8-dichloro-2-[(E)-2-phenylethenyl]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 134096982 |
| Molecular Formula | C16H9Cl2NO2 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 5,8-dichloro-2-[(E)-2-phenylethenyl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(/C=C/c2ccccc2)nc2c(Cl)ccc(Cl)c12 |
| InChI | InChI=1S/C16H9Cl2NO2/c17-11-7-8-12(18)15-14(11)16(20)21-13(19-15)9-6-10-4-2-1-3-5-10/h1-9H/b9-6+ |
| InChIKey | LHNDCFCGXRUJIK-RMKNXTFCSA-N |
| XLogP | 4.67 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |