About 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene
2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene (PubChem CID 175372114) has the molecular formula C23H17NOS
and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene.
Molecular Properties
| Compound Name | 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene |
| PubChem CID | 175372114 |
| Molecular Formula | C23H17NOS |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene |
| SMILES | C(=Cc1nc2c(ccc3ccccc32)o1)c1ccccc1.c1ccsc1 |
| InChI | InChI=1S/C19H13NO.C4H4S/c1-2-6-14(7-3-1)10-13-18-20-19-16-9-5-4-8-15(16)11-12-17(19)21-18;1-2-4-5-3-1/h1-13H;1-4H |
| InChIKey | DSABWOXKPLZBOG-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene?
The IUPAC name of 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene (CID 175372114) is 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene.
What is the SMILES notation for 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene?
The canonical SMILES for 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene is C(=Cc1nc2c(ccc3ccccc32)o1)c1ccccc1.c1ccsc1.
What is the InChIKey of 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene?
The InChIKey is DSABWOXKPLZBOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO.C4H4S/c1-2-6-14(7-3-1)10-13-18-20-19-16-9-5-4-8-15(16)11-12-17(19)21-18;1-2-4-5-3-1/h1-13H;1-4H.
What are the key properties of 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene?
2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene has a molecular weight of 355.46 g/mol, XLogP of 6.90, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethenyl)benzo[e][1,3]benzoxazole;thiophene is sourced from PubChem (CID 175372114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).