C13H6N2O2 — CID 72723209
3-oxobenzo[f][1,4]benzoxazine-2-carbonitrile (PubChem CID 72723209) has the molecular formula C13H6N2O2 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3-oxobenzo[f][1,4]benzoxazine-2-carbonitrile.
| Compound Name | 3-oxobenzo[f][1,4]benzoxazine-2-carbonitrile |
|---|---|
| PubChem CID | 72723209 |
| Molecular Formula | C13H6N2O2 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-oxobenzo[f][1,4]benzoxazine-2-carbonitrile |
| SMILES | N#Cc1nc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C13H6N2O2/c14-7-10-13(16)17-11-6-5-8-3-1-2-4-9(8)12(11)15-10/h1-6H |
| InChIKey | LFDIHCBOXGEXBO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|