C13H9NO3 — CID 83387453
methyl benzo[e][1,3]benzoxazole-2-carboxylate (PubChem CID 83387453) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl benzo[e][1,3]benzoxazole-2-carboxylate.
| Compound Name | methyl benzo[e][1,3]benzoxazole-2-carboxylate |
|---|---|
| PubChem CID | 83387453 |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | methyl benzo[e][1,3]benzoxazole-2-carboxylate |
| SMILES | COC(=O)c1nc2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C13H9NO3/c1-16-13(15)12-14-11-9-5-3-2-4-8(9)6-7-10(11)17-12/h2-7H,1H3 |
| InChIKey | WJUIYFXJUARUGE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |