methyl benzo[e][1,3]benzoxazole-2-carboxylate

C13H9NO3 — CID 83387453

IUPACmethyl benzo[e][1,3]benzoxazole-2-carboxylate
SMILESCOC(=O)c1nc2c(ccc3ccccc32)o1
InChIInChI=1S/C13H9NO3/c1-16-13(15)12-14-11-9-5-3-2-4-8(9)6-7-10(11)17-12/h2-7H,1H3
InChIKeyWJUIYFXJUARUGE-UHFFFAOYSA-N
MW227.22 g/mol
LogP2.77
Rot. Bonds1

About methyl benzo[e][1,3]benzoxazole-2-carboxylate

methyl benzo[e][1,3]benzoxazole-2-carboxylate (PubChem CID 83387453) has the molecular formula C13H9NO3 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl benzo[e][1,3]benzoxazole-2-carboxylate.

Molecular Properties

Compound Namemethyl benzo[e][1,3]benzoxazole-2-carboxylate
PubChem CID83387453
Molecular FormulaC13H9NO3
Molecular Weight227.22 g/mol
Exact Mass227.06
IUPAC Namemethyl benzo[e][1,3]benzoxazole-2-carboxylate
SMILESCOC(=O)c1nc2c(ccc3ccccc32)o1
InChIInChI=1S/C13H9NO3/c1-16-13(15)12-14-11-9-5-3-2-4-8(9)6-7-10(11)17-12/h2-7H,1H3
InChIKeyWJUIYFXJUARUGE-UHFFFAOYSA-N
XLogP2.77
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl benzo[e][1,3]benzoxazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl benzo[e][1,3]benzoxazole-2-carboxylate?
The IUPAC name of methyl benzo[e][1,3]benzoxazole-2-carboxylate (CID 83387453) is methyl benzo[e][1,3]benzoxazole-2-carboxylate.
What is the SMILES notation for methyl benzo[e][1,3]benzoxazole-2-carboxylate?
The canonical SMILES for methyl benzo[e][1,3]benzoxazole-2-carboxylate is COC(=O)c1nc2c(ccc3ccccc32)o1.
What is the InChIKey of methyl benzo[e][1,3]benzoxazole-2-carboxylate?
The InChIKey is WJUIYFXJUARUGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3/c1-16-13(15)12-14-11-9-5-3-2-4-8(9)6-7-10(11)17-12/h2-7H,1H3.
What are the key properties of methyl benzo[e][1,3]benzoxazole-2-carboxylate?
methyl benzo[e][1,3]benzoxazole-2-carboxylate has a molecular weight of 227.22 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl benzo[e][1,3]benzoxazole-2-carboxylate is sourced from PubChem (CID 83387453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).