C17H11NO3S — CID 165354587
methyl 5-benzo[e][1,3]benzoxazol-2-ylthiophene-2-carboxylate (PubChem CID 165354587) has the molecular formula C17H11NO3S and a molecular weight of 309.35 g/mol. Its IUPAC name is methyl 5-benzo[e][1,3]benzoxazol-2-ylthiophene-2-carboxylate.
| Compound Name | methyl 5-benzo[e][1,3]benzoxazol-2-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 165354587 |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | methyl 5-benzo[e][1,3]benzoxazol-2-ylthiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nc3c(ccc4ccccc43)o2)s1 |
| InChI | InChI=1S/C17H11NO3S/c1-20-17(19)14-9-8-13(22-14)16-18-15-11-5-3-2-4-10(11)6-7-12(15)21-16/h2-9H,1H3 |
| InChIKey | XQSLBHSHTSMGFW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |