methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate

C20H14O3 — CID 71059270

IUPACmethyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate
SMILESCOC(=O)c1c(-c2cc3ccccc3o2)ccc2ccccc12
InChIInChI=1S/C20H14O3/c1-22-20(21)19-15-8-4-2-6-13(15)10-11-16(19)18-12-14-7-3-5-9-17(14)23-18/h2-12H,1H3
InChIKeyFOOKNAOKJBVCEJ-UHFFFAOYSA-N
MW302.33 g/mol
LogP5.04
Rot. Bonds2

About methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate

methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate (PubChem CID 71059270) has the molecular formula C20H14O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate.

Molecular Properties

Compound Namemethyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate
PubChem CID71059270
Molecular FormulaC20H14O3
Molecular Weight302.33 g/mol
Exact Mass302.09
IUPAC Namemethyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate
SMILESCOC(=O)c1c(-c2cc3ccccc3o2)ccc2ccccc12
InChIInChI=1S/C20H14O3/c1-22-20(21)19-15-8-4-2-6-13(15)10-11-16(19)18-12-14-7-3-5-9-17(14)23-18/h2-12H,1H3
InChIKeyFOOKNAOKJBVCEJ-UHFFFAOYSA-N
XLogP5.04
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500302.33
LogP ≤ 55.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate?
The IUPAC name of methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate (CID 71059270) is methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate.
What is the SMILES notation for methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate?
The canonical SMILES for methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate is COC(=O)c1c(-c2cc3ccccc3o2)ccc2ccccc12.
What is the InChIKey of methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate?
The InChIKey is FOOKNAOKJBVCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O3/c1-22-20(21)19-15-8-4-2-6-13(15)10-11-16(19)18-12-14-7-3-5-9-17(14)23-18/h2-12H,1H3.
What are the key properties of methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate?
methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate has a molecular weight of 302.33 g/mol, XLogP of 5.04, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-benzofuran-2-yl)naphthalene-1-carboxylate is sourced from PubChem (CID 71059270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).