C13H9NO3S — CID 80572975
methyl 2-(1-benzofuran-2-yl)-1,3-thiazole-5-carboxylate (PubChem CID 80572975) has the molecular formula C13H9NO3S and a molecular weight of 259.29 g/mol. Its IUPAC name is methyl 2-(1-benzofuran-2-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(1-benzofuran-2-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80572975 |
| Molecular Formula | C13H9NO3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | methyl 2-(1-benzofuran-2-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(-c2cc3ccccc3o2)s1 |
| InChI | InChI=1S/C13H9NO3S/c1-16-13(15)11-7-14-12(18-11)10-6-8-4-2-3-5-9(8)17-10/h2-7H,1H3 |
| InChIKey | ACOSYVCLAKXCNS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |