C14H11NO4 — CID 154791615
ethyl 5-(1-benzofuran-2-yl)-1,2-oxazole-3-carboxylate (PubChem CID 154791615) has the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. Its IUPAC name is ethyl 5-(1-benzofuran-2-yl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(1-benzofuran-2-yl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791615 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | ethyl 5-(1-benzofuran-2-yl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc3ccccc3o2)on1 |
| InChI | InChI=1S/C14H11NO4/c1-2-17-14(16)10-8-13(19-15-10)12-7-9-5-3-4-6-11(9)18-12/h3-8H,2H2,1H3 |
| InChIKey | HWISQBWXLZYHEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |