C22H13NO6 — CID 30608554
[5-(1-benzofuran-2-yl)-1,2-oxazol-3-yl]methyl 2-oxochromene-3-carboxylate (PubChem CID 30608554) has the molecular formula C22H13NO6 and a molecular weight of 387.35 g/mol. Its IUPAC name is [5-(1-benzofuran-2-yl)-1,2-oxazol-3-yl]methyl 2-oxochromene-3-carboxylate.
| Compound Name | [5-(1-benzofuran-2-yl)-1,2-oxazol-3-yl]methyl 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 30608554 |
| Molecular Formula | C22H13NO6 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [5-(1-benzofuran-2-yl)-1,2-oxazol-3-yl]methyl 2-oxochromene-3-carboxylate |
| SMILES | O=C(OCc1cc(-c2cc3ccccc3o2)on1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H13NO6/c24-21(16-9-13-5-1-4-8-18(13)28-22(16)25)26-12-15-11-20(29-23-15)19-10-14-6-2-3-7-17(14)27-19/h1-11H,12H2 |
| InChIKey | CQPBDTCOAZFNID-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 95.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|