C19H14N2O4S — CID 91305542
[2-amino-2-(1,3-benzothiazol-2-yl)ethyl] 2-oxochromene-3-carboxylate (PubChem CID 91305542) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is [2-amino-2-(1,3-benzothiazol-2-yl)ethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-amino-2-(1,3-benzothiazol-2-yl)ethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 91305542 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | [2-amino-2-(1,3-benzothiazol-2-yl)ethyl] 2-oxochromene-3-carboxylate |
| SMILES | NC(COC(=O)c1cc2ccccc2oc1=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H14N2O4S/c20-13(17-21-14-6-2-4-8-16(14)26-17)10-24-18(22)12-9-11-5-1-3-7-15(11)25-19(12)23/h1-9,13H,10,20H2 |
| InChIKey | FYFKRSPPPNMERI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|