C25H20O6 — CID 144565309
3,3-bis(4-hydroxyphenyl)propyl 2-oxochromene-3-carboxylate (PubChem CID 144565309) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is 3,3-bis(4-hydroxyphenyl)propyl 2-oxochromene-3-carboxylate.
| Compound Name | 3,3-bis(4-hydroxyphenyl)propyl 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 144565309 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)propyl 2-oxochromene-3-carboxylate |
| SMILES | O=C(OCCC(c1ccc(O)cc1)c1ccc(O)cc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C25H20O6/c26-19-9-5-16(6-10-19)21(17-7-11-20(27)12-8-17)13-14-30-24(28)22-15-18-3-1-2-4-23(18)31-25(22)29/h1-12,15,21,26-27H,13-14H2 |
| InChIKey | FRZZIQRHMPJBBY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|