C17H10N2O5S — CID 3878538
(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-oxochromene-3-carboxylate (PubChem CID 3878538) has the molecular formula C17H10N2O5S and a molecular weight of 354.34 g/mol. Its IUPAC name is (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-oxochromene-3-carboxylate.
| Compound Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 3878538 |
| Molecular Formula | C17H10N2O5S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | (5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 2-oxochromene-3-carboxylate |
| SMILES | O=C(OCc1cc(=O)n2ccsc2n1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H10N2O5S/c20-14-8-11(18-17-19(14)5-6-25-17)9-23-15(21)12-7-10-3-1-2-4-13(10)24-16(12)22/h1-8H,9H2 |
| InChIKey | NBRWAQGXPOTZEX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|