C14H12N2O5S2 — CID 87157744
ethyl 2-(1-benzofuran-2-ylsulfonylamino)-1,3-thiazole-4-carboxylate (PubChem CID 87157744) has the molecular formula C14H12N2O5S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl 2-(1-benzofuran-2-ylsulfonylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(1-benzofuran-2-ylsulfonylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 87157744 |
| Molecular Formula | C14H12N2O5S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | ethyl 2-(1-benzofuran-2-ylsulfonylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NS(=O)(=O)c2cc3ccccc3o2)n1 |
| InChI | InChI=1S/C14H12N2O5S2/c1-2-20-13(17)10-8-22-14(15-10)16-23(18,19)12-7-9-5-3-4-6-11(9)21-12/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | HGKPFFNRPWRRLB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |