About ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate
ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate (PubChem CID 51108617) has the molecular formula C12H14N2O4S3
and a molecular weight of 346.46 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate |
| PubChem CID | 51108617 |
| Molecular Formula | C12H14N2O4S3 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NS(=O)(=O)c2cc(C)sc2C)n1 |
| InChI | InChI=1S/C12H14N2O4S3/c1-4-18-11(15)9-6-19-12(13-9)14-21(16,17)10-5-7(2)20-8(10)3/h5-6H,4H2,1-3H3,(H,13,14) |
| InChIKey | XLBIHUVQIWTURS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate?
The IUPAC name of ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate (CID 51108617) is ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate?
The canonical SMILES for ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(NS(=O)(=O)c2cc(C)sc2C)n1.
What is the InChIKey of ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate?
The InChIKey is XLBIHUVQIWTURS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4S3/c1-4-18-11(15)9-6-19-12(13-9)14-21(16,17)10-5-7(2)20-8(10)3/h5-6H,4H2,1-3H3,(H,13,14).
What are the key properties of ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate?
ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate has a molecular weight of 346.46 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2,5-dimethylthiophen-3-yl)sulfonylamino]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 51108617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).