C12H10ClNO3 — CID 13035537
ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 13035537) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 13035537 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C12H10ClNO3/c1-2-16-12(15)10-7-11(17-14-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3 |
| InChIKey | CJQWCZKLLDAKCX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |