C12H8Cl2FNO3 — CID 154791538
ethyl 5-(2,6-dichloro-3-fluorophenyl)-1,2-oxazole-3-carboxylate (PubChem CID 154791538) has the molecular formula C12H8Cl2FNO3 and a molecular weight of 304.10 g/mol. Its IUPAC name is ethyl 5-(2,6-dichloro-3-fluorophenyl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(2,6-dichloro-3-fluorophenyl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 154791538 |
| Molecular Formula | C12H8Cl2FNO3 |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | ethyl 5-(2,6-dichloro-3-fluorophenyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2c(Cl)ccc(F)c2Cl)on1 |
| InChI | InChI=1S/C12H8Cl2FNO3/c1-2-18-12(17)8-5-9(19-16-8)10-6(13)3-4-7(15)11(10)14/h3-5H,2H2,1H3 |
| InChIKey | HXQHLCSFBUWZMY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|