C11H11N3O4 — CID 5063334
ethyl 5-(2-acetylpyrazol-3-yl)-1,2-oxazole-3-carboxylate (PubChem CID 5063334) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is ethyl 5-(2-acetylpyrazol-3-yl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(2-acetylpyrazol-3-yl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 5063334 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | ethyl 5-(2-acetylpyrazol-3-yl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccnn2C(C)=O)on1 |
| InChI | InChI=1S/C11H11N3O4/c1-3-17-11(16)8-6-10(18-13-8)9-4-5-12-14(9)7(2)15/h4-6H,3H2,1-2H3 |
| InChIKey | MCSRJXBNLFRGQU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |