C14H12N2O3 — CID 168876067
ethyl 5-(1H-indol-5-yl)-1,2-oxazole-3-carboxylate (PubChem CID 168876067) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is ethyl 5-(1H-indol-5-yl)-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-(1H-indol-5-yl)-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 168876067 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | ethyl 5-(1H-indol-5-yl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc3[nH]ccc3c2)on1 |
| InChI | InChI=1S/C14H12N2O3/c1-2-18-14(17)12-8-13(19-16-12)10-3-4-11-9(7-10)5-6-15-11/h3-8,15H,2H2,1H3 |
| InChIKey | UROFHVCLNFVVMA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |