C28H29NO4Si — CID 44818827
ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxyphenyl]-1,2-oxazole-3-carboxylate (PubChem CID 44818827) has the molecular formula C28H29NO4Si and a molecular weight of 471.63 g/mol. Its IUPAC name is ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxyphenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxyphenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 44818827 |
| Molecular Formula | C28H29NO4Si |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | ethyl 5-[3-[tert-butyl(diphenyl)silyl]oxyphenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c2)on1 |
| InChI | InChI=1S/C28H29NO4Si/c1-5-31-27(30)25-20-26(32-29-25)21-13-12-14-22(19-21)33-34(28(2,3)4,23-15-8-6-9-16-23)24-17-10-7-11-18-24/h6-20H,5H2,1-4H3 |
| InChIKey | ITWKPQLZKSVSOM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|